C21H23NO3S — CID 146661433
(E)-3-(3,4-dimethoxyphenyl)-N-phenyl-N-(thiolan-3-yl)prop-2-enamide (PubChem CID 146661433) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-phenyl-N-(thiolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-phenyl-N-(thiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 146661433 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-phenyl-N-(thiolan-3-yl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(c2ccccc2)C2CCSC2)cc1OC |
| InChI | InChI=1S/C21H23NO3S/c1-24-19-10-8-16(14-20(19)25-2)9-11-21(23)22(18-12-13-26-15-18)17-6-4-3-5-7-17/h3-11,14,18H,12-13,15H2,1-2H3/b11-9+ |
| InChIKey | XJTDWTRGYCZCHO-PKNBQFBNSA-N |
| XLogP | 4.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|