C26H44N2O5 — CID 146665632
tert-butyl N-[(2S)-7-(2,5-dimethoxy-3,4,6-trimethylphenyl)-1-oxo-1-(propan-2-ylamino)heptan-2-yl]carbamate (PubChem CID 146665632) has the molecular formula C26H44N2O5 and a molecular weight of 464.65 g/mol. Its IUPAC name is tert-butyl N-[(2S)-7-(2,5-dimethoxy-3,4,6-trimethylphenyl)-1-oxo-1-(propan-2-ylamino)heptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-7-(2,5-dimethoxy-3,4,6-trimethylphenyl)-1-oxo-1-(propan-2-ylamino)heptan-2-yl]carbamate |
|---|---|
| PubChem CID | 146665632 |
| Molecular Formula | C26H44N2O5 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | tert-butyl N-[(2S)-7-(2,5-dimethoxy-3,4,6-trimethylphenyl)-1-oxo-1-(propan-2-ylamino)heptan-2-yl]carbamate |
| SMILES | COc1c(C)c(C)c(OC)c(CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)NC(C)C)c1C |
| InChI | InChI=1S/C26H44N2O5/c1-16(2)27-24(29)21(28-25(30)33-26(6,7)8)15-13-11-12-14-20-19(5)22(31-9)17(3)18(4)23(20)32-10/h16,21H,11-15H2,1-10H3,(H,27,29)(H,28,30)/t21-/m0/s1 |
| InChIKey | DVLJCTPCELMNDP-NRFANRHFSA-N |
| XLogP | 5.15 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|