C10H14F3N — CID 146671387
(2E,4E)-N,5-dimethyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-amine (PubChem CID 146671387) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is (2E,4E)-N,5-dimethyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4E)-N,5-dimethyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 146671387 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (2E,4E)-N,5-dimethyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(C)=C(\C=C(/C)NC)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N/c1-5-7(2)9(10(11,12)13)6-8(3)14-4/h5-6,14H,1H2,2-4H3/b8-6+,9-7+ |
| InChIKey | YXWHXKMCMTWDIH-CDJQDVQCSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|