C14H14BrN3O2 — CID 146674111
6-(2-methoxyphenyl)-1-methyl-7H-imidazo[1,2-a]pyrazin-1-ium-8-one bromide (PubChem CID 146674111) has the molecular formula C14H14BrN3O2 and a molecular weight of 336.19 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-1-methyl-7H-imidazo[1,2-a]pyrazin-1-ium-8-one bromide.
| Compound Name | 6-(2-methoxyphenyl)-1-methyl-7H-imidazo[1,2-a]pyrazin-1-ium-8-one bromide |
|---|---|
| PubChem CID | 146674111 |
| Molecular Formula | C14H14BrN3O2 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 6-(2-methoxyphenyl)-1-methyl-7H-imidazo[1,2-a]pyrazin-1-ium-8-one bromide |
| SMILES | COc1ccccc1-c1cn2cc[n+](C)c2c(=O)[nH]1.[Br-] |
| InChI | InChI=1S/C14H13N3O2.BrH/c1-16-7-8-17-9-11(15-13(18)14(16)17)10-5-3-4-6-12(10)19-2;/h3-9H,1-2H3;1H |
| InChIKey | QLZMTEJNONTKAM-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|