C25H28N4O2 — CID 146674303
(1R,9R)-11-[2-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 146674303) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is (1R,9R)-11-[2-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9R)-11-[2-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 146674303 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (1R,9R)-11-[2-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CN(C(=O)CN1C[C@H]2C[C@H](C1)c1cccc(=O)n1C2)CC3 |
| InChI | InChI=1S/C25H28N4O2/c1-16-5-6-21-19(9-16)20-14-28(8-7-22(20)26-21)25(31)15-27-11-17-10-18(13-27)23-3-2-4-24(30)29(23)12-17/h2-6,9,17-18,26H,7-8,10-15H2,1H3/t17-,18-/m1/s1 |
| InChIKey | FAHKQVDBQYDALV-QZTJIDSGSA-N |
| XLogP | 2.64 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|