C24H25FN4O2 — CID 3752595
11-[2-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 3752595) has the molecular formula C24H25FN4O2 and a molecular weight of 420.49 g/mol. Its IUPAC name is 11-[2-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | 11-[2-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 3752595 |
| Molecular Formula | C24H25FN4O2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 11-[2-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-2-oxoethyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=C(CN1CC2CC(C1)c1cccc(=O)n1C2)N1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C24H25FN4O2/c25-17-4-5-20-18(9-17)19-13-28(7-6-21(19)26-20)24(31)14-27-10-15-8-16(12-27)22-2-1-3-23(30)29(22)11-15/h1-5,9,15-16,26H,6-8,10-14H2 |
| InChIKey | CQWNDXGVDUSZRS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|