C22H22N2O3 — CID 43060957
(2-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 43060957) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is (2-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | (2-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 43060957 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (2-methyl-2,3-dihydro-1,4-benzodioxin-3-yl)-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CN(C(=O)C1Oc2ccccc2OC1C)CC3 |
| InChI | InChI=1S/C22H22N2O3/c1-13-7-8-17-15(11-13)16-12-24(10-9-18(16)23-17)22(25)21-14(2)26-19-5-3-4-6-20(19)27-21/h3-8,11,14,21,23H,9-10,12H2,1-2H3 |
| InChIKey | OVPZKIKDBRKFNX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|