C21H20ClF3N2O — CID 146701944
N-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine (PubChem CID 146701944) has the molecular formula C21H20ClF3N2O and a molecular weight of 408.85 g/mol. Its IUPAC name is N-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine.
| Compound Name | N-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine |
|---|---|
| PubChem CID | 146701944 |
| Molecular Formula | C21H20ClF3N2O |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine |
| SMILES | FC(F)(F)c1ccc(Cl)c(C/N=C2\Nc3ccccc3CC23CCOCC3)c1 |
| InChI | InChI=1S/C21H20ClF3N2O/c22-17-6-5-16(21(23,24)25)11-15(17)13-26-19-20(7-9-28-10-8-20)12-14-3-1-2-4-18(14)27-19/h1-6,11H,7-10,12-13H2,(H,26,27) |
| InChIKey | QWADOHJAYUQFNO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|