C14H29BN4O5 — CID 146723579
(3R,5S)-3-amino-5-(2-boronoethyl)-1-[(2S)-2,6-diaminohexanoyl]piperidine-3-carboxylic acid (PubChem CID 146723579) has the molecular formula C14H29BN4O5 and a molecular weight of 344.22 g/mol. Its IUPAC name is (3R,5S)-3-amino-5-(2-boronoethyl)-1-[(2S)-2,6-diaminohexanoyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-3-amino-5-(2-boronoethyl)-1-[(2S)-2,6-diaminohexanoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 146723579 |
| Molecular Formula | C14H29BN4O5 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (3R,5S)-3-amino-5-(2-boronoethyl)-1-[(2S)-2,6-diaminohexanoyl]piperidine-3-carboxylic acid |
| SMILES | NCCCC[C@H](N)C(=O)N1C[C@@H](CCB(O)O)C[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C14H29BN4O5/c16-6-2-1-3-11(17)12(20)19-8-10(4-5-15(23)24)7-14(18,9-19)13(21)22/h10-11,23-24H,1-9,16-18H2,(H,21,22)/t10-,11-,14+/m0/s1 |
| InChIKey | RFLLKKLVSPBDNC-COPLHBTASA-N |
| XLogP | -2.06 |
| TPSA | 176.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|