C12H24BN3O6 — CID 148578100
(3R,5S)-3-amino-1-[(2S,3R)-2-amino-3-hydroxybutanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid (PubChem CID 148578100) has the molecular formula C12H24BN3O6 and a molecular weight of 317.15 g/mol. Its IUPAC name is (3R,5S)-3-amino-1-[(2S,3R)-2-amino-3-hydroxybutanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-3-amino-1-[(2S,3R)-2-amino-3-hydroxybutanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 148578100 |
| Molecular Formula | C12H24BN3O6 |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (3R,5S)-3-amino-1-[(2S,3R)-2-amino-3-hydroxybutanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N1C[C@@H](CCB(O)O)C[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C12H24BN3O6/c1-7(17)9(14)10(18)16-5-8(2-3-13(21)22)4-12(15,6-16)11(19)20/h7-9,17,21-22H,2-6,14-15H2,1H3,(H,19,20)/t7-,8+,9+,12-/m1/s1 |
| InChIKey | MYESWCPHZVFPIZ-JDVQERKKSA-N |
| XLogP | -2.81 |
| TPSA | 170.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|