C13H26BN3O5 — CID 149424236
(3R,5S)-3-amino-1-[(2S)-2-amino-3-methylbutanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid (PubChem CID 149424236) has the molecular formula C13H26BN3O5 and a molecular weight of 315.18 g/mol. Its IUPAC name is (3R,5S)-3-amino-1-[(2S)-2-amino-3-methylbutanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-3-amino-1-[(2S)-2-amino-3-methylbutanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 149424236 |
| Molecular Formula | C13H26BN3O5 |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | (3R,5S)-3-amino-1-[(2S)-2-amino-3-methylbutanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid |
| SMILES | CC(C)[C@H](N)C(=O)N1C[C@@H](CCB(O)O)C[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C13H26BN3O5/c1-8(2)10(15)11(18)17-6-9(3-4-14(21)22)5-13(16,7-17)12(19)20/h8-10,21-22H,3-7,15-16H2,1-2H3,(H,19,20)/t9-,10-,13+/m0/s1 |
| InChIKey | YTTYBAWLMIWBTG-OUJBWJOFSA-N |
| XLogP | -1.54 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|