C12H22BN3O7 — CID 147988206
(3R,5S)-3-amino-1-[(2S)-2-amino-3-carboxypropanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid (PubChem CID 147988206) has the molecular formula C12H22BN3O7 and a molecular weight of 331.13 g/mol. Its IUPAC name is (3R,5S)-3-amino-1-[(2S)-2-amino-3-carboxypropanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-3-amino-1-[(2S)-2-amino-3-carboxypropanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 147988206 |
| Molecular Formula | C12H22BN3O7 |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (3R,5S)-3-amino-1-[(2S)-2-amino-3-carboxypropanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)N1C[C@@H](CCB(O)O)C[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C12H22BN3O7/c14-8(3-9(17)18)10(19)16-5-7(1-2-13(22)23)4-12(15,6-16)11(20)21/h7-8,22-23H,1-6,14-15H2,(H,17,18)(H,20,21)/t7-,8-,12+/m0/s1 |
| InChIKey | IUNRVTHSNNAMLD-YVZVNANGSA-N |
| XLogP | -2.72 |
| TPSA | 187.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|