C14H28BN3O5 — CID 151318691
(3R,5S)-3-amino-1-[(2S,3S)-2-amino-3-methylpentanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid (PubChem CID 151318691) has the molecular formula C14H28BN3O5 and a molecular weight of 329.21 g/mol. Its IUPAC name is (3R,5S)-3-amino-1-[(2S,3S)-2-amino-3-methylpentanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-3-amino-1-[(2S,3S)-2-amino-3-methylpentanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 151318691 |
| Molecular Formula | C14H28BN3O5 |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | (3R,5S)-3-amino-1-[(2S,3S)-2-amino-3-methylpentanoyl]-5-(2-boronoethyl)piperidine-3-carboxylic acid |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N1C[C@@H](CCB(O)O)C[C@](N)(C(=O)O)C1 |
| InChI | InChI=1S/C14H28BN3O5/c1-3-9(2)11(16)12(19)18-7-10(4-5-15(22)23)6-14(17,8-18)13(20)21/h9-11,22-23H,3-8,16-17H2,1-2H3,(H,20,21)/t9-,10-,11-,14+/m0/s1 |
| InChIKey | OFZLZTLTCDQLGK-AYGWYOGXSA-N |
| XLogP | -1.15 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|