C22H18BrNO3S — CID 146765258
(E)-N-(4-benzylsulfonylphenyl)-3-(2-bromophenyl)prop-2-enamide (PubChem CID 146765258) has the molecular formula C22H18BrNO3S and a molecular weight of 456.36 g/mol. Its IUPAC name is (E)-N-(4-benzylsulfonylphenyl)-3-(2-bromophenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-benzylsulfonylphenyl)-3-(2-bromophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 146765258 |
| Molecular Formula | C22H18BrNO3S |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | (E)-N-(4-benzylsulfonylphenyl)-3-(2-bromophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Br)Nc1ccc(S(=O)(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H18BrNO3S/c23-21-9-5-4-8-18(21)10-15-22(25)24-19-11-13-20(14-12-19)28(26,27)16-17-6-2-1-3-7-17/h1-15H,16H2,(H,24,25)/b15-10+ |
| InChIKey | RQMMRPJKLJLRCE-XNTDXEJSSA-N |
| XLogP | 5.07 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|