C14H26N2O4 — CID 146780831
tert-butyl N-[(3S,4R)-1-imino-4-[(2-methylpropan-2-yl)oxy]-2-oxopentan-3-yl]carbamate (PubChem CID 146780831) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R)-1-imino-4-[(2-methylpropan-2-yl)oxy]-2-oxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R)-1-imino-4-[(2-methylpropan-2-yl)oxy]-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 146780831 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | tert-butyl N-[(3S,4R)-1-imino-4-[(2-methylpropan-2-yl)oxy]-2-oxopentan-3-yl]carbamate |
| SMILES | [H]/N=C/C(=O)[C@@H](NC(=O)OC(C)(C)C)[C@@H](C)OC(C)(C)C |
| InChI | InChI=1S/C14H26N2O4/c1-9(19-13(2,3)4)11(10(17)8-15)16-12(18)20-14(5,6)7/h8-9,11,15H,1-7H3,(H,16,18)/b15-8+/t9-,11+/m1/s1 |
| InChIKey | RTQFFJNVLMWXQM-YPPLULGKSA-N |
| XLogP | 2.30 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|