C24H22O6 — CID 14681547
(2Z)-2-[(E)-1-hydroxy-3-phenylprop-2-enylidene]-4a,9a-dimethoxy-4,9-dihydroxanthene-1,3-dione (PubChem CID 14681547) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is (2Z)-2-[(E)-1-hydroxy-3-phenylprop-2-enylidene]-4a,9a-dimethoxy-4,9-dihydroxanthene-1,3-dione.
| Compound Name | (2Z)-2-[(E)-1-hydroxy-3-phenylprop-2-enylidene]-4a,9a-dimethoxy-4,9-dihydroxanthene-1,3-dione |
|---|---|
| PubChem CID | 14681547 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (2Z)-2-[(E)-1-hydroxy-3-phenylprop-2-enylidene]-4a,9a-dimethoxy-4,9-dihydroxanthene-1,3-dione |
| SMILES | COC12CC(=O)/C(=C(O)\C=C\c3ccccc3)C(=O)C1(OC)Cc1ccccc1O2 |
| InChI | InChI=1S/C24H22O6/c1-28-23-14-17-10-6-7-11-20(17)30-24(23,29-2)15-19(26)21(22(23)27)18(25)13-12-16-8-4-3-5-9-16/h3-13,25H,14-15H2,1-2H3/b13-12+,21-18- |
| InChIKey | DTOFGOYMLFWLBI-CXPPDOQTSA-N |
| XLogP | 3.42 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|