C23H23F3S — CID 146819877
4,4-dimethyl-1-(3-methylphenyl)-6-[3-methyl-5-(trifluoromethyl)phenyl]hex-5-yne-2-thione (PubChem CID 146819877) has the molecular formula C23H23F3S and a molecular weight of 388.50 g/mol. Its IUPAC name is 4,4-dimethyl-1-(3-methylphenyl)-6-[3-methyl-5-(trifluoromethyl)phenyl]hex-5-yne-2-thione.
| Compound Name | 4,4-dimethyl-1-(3-methylphenyl)-6-[3-methyl-5-(trifluoromethyl)phenyl]hex-5-yne-2-thione |
|---|---|
| PubChem CID | 146819877 |
| Molecular Formula | C23H23F3S |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4,4-dimethyl-1-(3-methylphenyl)-6-[3-methyl-5-(trifluoromethyl)phenyl]hex-5-yne-2-thione |
| SMILES | Cc1cccc(CC(=S)CC(C)(C)C#Cc2cc(C)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H23F3S/c1-16-6-5-7-18(10-16)14-21(27)15-22(3,4)9-8-19-11-17(2)12-20(13-19)23(24,25)26/h5-7,10-13H,14-15H2,1-4H3 |
| InChIKey | SBVHSBJJZDLTFN-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|