C15H21N3O7 — CID 146884780
2-[[1-carboxy-2-(furan-2-yl)ethyl]carbamoylamino]-6-formamidohexanoic acid (PubChem CID 146884780) has the molecular formula C15H21N3O7 and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-[[1-carboxy-2-(furan-2-yl)ethyl]carbamoylamino]-6-formamidohexanoic acid.
| Compound Name | 2-[[1-carboxy-2-(furan-2-yl)ethyl]carbamoylamino]-6-formamidohexanoic acid |
|---|---|
| PubChem CID | 146884780 |
| Molecular Formula | C15H21N3O7 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[[1-carboxy-2-(furan-2-yl)ethyl]carbamoylamino]-6-formamidohexanoic acid |
| SMILES | O=CNCCCCC(NC(=O)NC(Cc1ccco1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H21N3O7/c19-9-16-6-2-1-5-11(13(20)21)17-15(24)18-12(14(22)23)8-10-4-3-7-25-10/h3-4,7,9,11-12H,1-2,5-6,8H2,(H,16,19)(H,20,21)(H,22,23)(H2,17,18,24) |
| InChIKey | SVORUWJIFXZYQV-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|