C17H21N3O5 — CID 102485172
(2S)-6-formamido-2-[[(4S)-2-phenyl-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]hexanoic acid (PubChem CID 102485172) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is (2S)-6-formamido-2-[[(4S)-2-phenyl-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]hexanoic acid.
| Compound Name | (2S)-6-formamido-2-[[(4S)-2-phenyl-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 102485172 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (2S)-6-formamido-2-[[(4S)-2-phenyl-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]hexanoic acid |
| SMILES | O=CNCCCC[C@H](NC(=O)[C@@H]1COC(c2ccccc2)=N1)C(=O)O |
| InChI | InChI=1S/C17H21N3O5/c21-11-18-9-5-4-8-13(17(23)24)19-15(22)14-10-25-16(20-14)12-6-2-1-3-7-12/h1-3,6-7,11,13-14H,4-5,8-10H2,(H,18,21)(H,19,22)(H,23,24)/t13-,14-/m0/s1 |
| InChIKey | NRQMXAYXYIZYHC-KBPBESRZSA-N |
| XLogP | 0.32 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|