C10H12Cl2N2O2 — CID 14693188
5-amino-7-chloro-4-hydroxy-3,3-dimethyl-1H-indol-2-one;hydrochloride (PubChem CID 14693188) has the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. Its IUPAC name is 5-amino-7-chloro-4-hydroxy-3,3-dimethyl-1H-indol-2-one;hydrochloride.
| Compound Name | 5-amino-7-chloro-4-hydroxy-3,3-dimethyl-1H-indol-2-one;hydrochloride |
|---|---|
| PubChem CID | 14693188 |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 5-amino-7-chloro-4-hydroxy-3,3-dimethyl-1H-indol-2-one;hydrochloride |
| SMILES | CC1(C)C(=O)Nc2c(Cl)cc(N)c(O)c21.Cl |
| InChI | InChI=1S/C10H11ClN2O2.ClH/c1-10(2)6-7(13-9(10)15)4(11)3-5(12)8(6)14;/h3,14H,12H2,1-2H3,(H,13,15);1H |
| InChIKey | AJTICGUQBVQKON-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|