C24H21Cl2N3O5S — CID 18724694
4-chloro-N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-[(4-methylphenoxy)sulfinylamino]benzamide (PubChem CID 18724694) has the molecular formula C24H21Cl2N3O5S and a molecular weight of 534.42 g/mol. Its IUPAC name is 4-chloro-N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-[(4-methylphenoxy)sulfinylamino]benzamide.
| Compound Name | 4-chloro-N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-[(4-methylphenoxy)sulfinylamino]benzamide |
|---|---|
| PubChem CID | 18724694 |
| Molecular Formula | C24H21Cl2N3O5S |
| Molecular Weight | 534.42 g/mol |
| Exact Mass | 533.06 |
| IUPAC Name | 4-chloro-N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-[(4-methylphenoxy)sulfinylamino]benzamide |
| SMILES | Cc1ccc(OS(=O)Nc2cc(C(=O)Nc3cc(Cl)c4c(c3O)C(C)(C)C(=O)N4)ccc2Cl)cc1 |
| InChI | InChI=1S/C24H21Cl2N3O5S/c1-12-4-7-14(8-5-12)34-35(33)29-17-10-13(6-9-15(17)25)22(31)27-18-11-16(26)20-19(21(18)30)24(2,3)23(32)28-20/h4-11,29-30H,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | FIALWRXEVRSDIO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|