C13H12Cl3NO4 — CID 14695579
methyl 3-methyl-2-[(2,4,6-trichlorophenyl)carbamoyloxy]but-3-enoate (PubChem CID 14695579) has the molecular formula C13H12Cl3NO4 and a molecular weight of 352.60 g/mol. Its IUPAC name is methyl 3-methyl-2-[(2,4,6-trichlorophenyl)carbamoyloxy]but-3-enoate.
| Compound Name | methyl 3-methyl-2-[(2,4,6-trichlorophenyl)carbamoyloxy]but-3-enoate |
|---|---|
| PubChem CID | 14695579 |
| Molecular Formula | C13H12Cl3NO4 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | methyl 3-methyl-2-[(2,4,6-trichlorophenyl)carbamoyloxy]but-3-enoate |
| SMILES | C=C(C)C(OC(=O)Nc1c(Cl)cc(Cl)cc1Cl)C(=O)OC |
| InChI | InChI=1S/C13H12Cl3NO4/c1-6(2)11(12(18)20-3)21-13(19)17-10-8(15)4-7(14)5-9(10)16/h4-5,11H,1H2,2-3H3,(H,17,19) |
| InChIKey | MXQUWESGMBRMLH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|