C26H36ClN7 — CID 146986498
1-[amino-(4-methylanilino)methylidene]-2-[11-(4-chlorophenyl)-8,10-diiminoundecyl]guanidine (PubChem CID 146986498) has the molecular formula C26H36ClN7 and a molecular weight of 482.08 g/mol. Its IUPAC name is 1-[amino-(4-methylanilino)methylidene]-2-[11-(4-chlorophenyl)-8,10-diiminoundecyl]guanidine.
| Compound Name | 1-[amino-(4-methylanilino)methylidene]-2-[11-(4-chlorophenyl)-8,10-diiminoundecyl]guanidine |
|---|---|
| PubChem CID | 146986498 |
| Molecular Formula | C26H36ClN7 |
| Molecular Weight | 482.08 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 1-[amino-(4-methylanilino)methylidene]-2-[11-(4-chlorophenyl)-8,10-diiminoundecyl]guanidine |
| SMILES | [H]/N=C(/CCCCCCC/N=C(\N)N=C(N)Nc1ccc(C)cc1)C/C(Cc1ccc(Cl)cc1)=N/[H] |
| InChI | InChI=1S/C26H36ClN7/c1-19-8-14-24(15-9-19)33-26(31)34-25(30)32-16-6-4-2-3-5-7-22(28)18-23(29)17-20-10-12-21(27)13-11-20/h8-15,28-29H,2-7,16-18H2,1H3,(H5,30,31,32,33,34)/b28-22-,29-23+ |
| InChIKey | APIYGJWDJBFXEF-XWFWGDPBSA-N |
| XLogP | 5.70 |
| TPSA | 136.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.08 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|