C13H21BN2O2 — CID 147009796
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5,6,7-tetrahydro-2H-indazole (PubChem CID 147009796) has the molecular formula C13H21BN2O2 and a molecular weight of 248.13 g/mol. Its IUPAC name is 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5,6,7-tetrahydro-2H-indazole.
| Compound Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5,6,7-tetrahydro-2H-indazole |
|---|---|
| PubChem CID | 147009796 |
| Molecular Formula | C13H21BN2O2 |
| Molecular Weight | 248.13 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5,6,7-tetrahydro-2H-indazole |
| SMILES | CC1(C)OB(c2[nH]nc3c2CCCC3)OC1(C)C |
| InChI | InChI=1S/C13H21BN2O2/c1-12(2)13(3,4)18-14(17-12)11-9-7-5-6-8-10(9)15-16-11/h5-8H2,1-4H3,(H,15,16) |
| InChIKey | ATQPGPLXBYBRGK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.13 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|