C31H24BrN3O — CID 147091273
11-bromo-8-[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 147091273) has the molecular formula C31H24BrN3O and a molecular weight of 534.46 g/mol. Its IUPAC name is 11-bromo-8-[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-bromo-8-[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 147091273 |
| Molecular Formula | C31H24BrN3O |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 11-bromo-8-[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(C)cc2)n2c3ccncc3c3ccc(Br)nc32)cc1 |
| InChI | InChI=1S/C31H24BrN3O/c1-21-8-10-23(11-9-21)31(22-6-4-3-5-7-22,24-12-14-25(36-2)15-13-24)35-28-18-19-33-20-27(28)26-16-17-29(32)34-30(26)35/h3-20H,1-2H3 |
| InChIKey | BIWAKNBISJFAGC-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|