C30H29N3O4 — CID 146503032
2-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]imidazo[4,5-c]pyridin-1-yl]ethanol (PubChem CID 146503032) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]imidazo[4,5-c]pyridin-1-yl]ethanol.
| Compound Name | 2-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]imidazo[4,5-c]pyridin-1-yl]ethanol |
|---|---|
| PubChem CID | 146503032 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 2-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]imidazo[4,5-c]pyridin-1-yl]ethanol |
| SMILES | COc1ccc(C(OCc2nc3cnccc3n2CCO)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H29N3O4/c1-35-25-12-8-23(9-13-25)30(22-6-4-3-5-7-22,24-10-14-26(36-2)15-11-24)37-21-29-32-27-20-31-17-16-28(27)33(29)18-19-34/h3-17,20,34H,18-19,21H2,1-2H3 |
| InChIKey | DWOLFIZIEHIRAF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|