C16H12O2S — CID 14709454
1,2-dihydronaphtho[1,2-b][1]benzothiole-1,2-diol (PubChem CID 14709454) has the molecular formula C16H12O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 1,2-dihydronaphtho[1,2-b][1]benzothiole-1,2-diol.
| Compound Name | 1,2-dihydronaphtho[1,2-b][1]benzothiole-1,2-diol |
|---|---|
| PubChem CID | 14709454 |
| Molecular Formula | C16H12O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1,2-dihydronaphtho[1,2-b][1]benzothiole-1,2-diol |
| SMILES | OC1C=Cc2ccc3c(sc4ccccc43)c2C1O |
| InChI | InChI=1S/C16H12O2S/c17-12-8-6-9-5-7-11-10-3-1-2-4-13(10)19-16(11)14(9)15(12)18/h1-8,12,15,17-18H |
| InChIKey | BYFVXOICIXESGI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |