C17H17N3O4S — CID 147127527
7-amino-5-(2-methoxyethoxy)-6-(2-sulfanylidene-1H-pyridin-3-yl)-1H-indole-2-carboxylic acid (PubChem CID 147127527) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is 7-amino-5-(2-methoxyethoxy)-6-(2-sulfanylidene-1H-pyridin-3-yl)-1H-indole-2-carboxylic acid.
| Compound Name | 7-amino-5-(2-methoxyethoxy)-6-(2-sulfanylidene-1H-pyridin-3-yl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 147127527 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 7-amino-5-(2-methoxyethoxy)-6-(2-sulfanylidene-1H-pyridin-3-yl)-1H-indole-2-carboxylic acid |
| SMILES | COCCOc1cc2cc(C(=O)O)[nH]c2c(N)c1-c1ccc[nH]c1=S |
| InChI | InChI=1S/C17H17N3O4S/c1-23-5-6-24-12-8-9-7-11(17(21)22)20-15(9)14(18)13(12)10-3-2-4-19-16(10)25/h2-4,7-8,20H,5-6,18H2,1H3,(H,19,25)(H,21,22) |
| InChIKey | BPOLEKHEENZYCQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 113.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|