C20H16N4O2 — CID 147133396
(3Z)-3-phenacylidene-1-[2-(1,2,4-triazol-1-yl)ethyl]indol-2-one (PubChem CID 147133396) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is (3Z)-3-phenacylidene-1-[2-(1,2,4-triazol-1-yl)ethyl]indol-2-one.
| Compound Name | (3Z)-3-phenacylidene-1-[2-(1,2,4-triazol-1-yl)ethyl]indol-2-one |
|---|---|
| PubChem CID | 147133396 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (3Z)-3-phenacylidene-1-[2-(1,2,4-triazol-1-yl)ethyl]indol-2-one |
| SMILES | O=C(/C=C1\C(=O)N(CCn2cncn2)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C20H16N4O2/c25-19(15-6-2-1-3-7-15)12-17-16-8-4-5-9-18(16)24(20(17)26)11-10-23-14-21-13-22-23/h1-9,12-14H,10-11H2/b17-12- |
| InChIKey | BQRDLEMKIYFWQF-ATVHPVEESA-N |
| XLogP | 2.59 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|