C18H13N3O — CID 1471355
3-(4-methylphenyl)-5-nitroso-2H-indeno[1,2-c]pyridazine (PubChem CID 1471355) has the molecular formula C18H13N3O and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-(4-methylphenyl)-5-nitroso-2H-indeno[1,2-c]pyridazine.
| Compound Name | 3-(4-methylphenyl)-5-nitroso-2H-indeno[1,2-c]pyridazine |
|---|---|
| PubChem CID | 1471355 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-(4-methylphenyl)-5-nitroso-2H-indeno[1,2-c]pyridazine |
| SMILES | Cc1ccc(-c2cc3c(N=O)c4ccccc4c-3n[nH]2)cc1 |
| InChI | InChI=1S/C18H13N3O/c1-11-6-8-12(9-7-11)16-10-15-17(20-19-16)13-4-2-3-5-14(13)18(15)21-22/h2-10,19H,1H3 |
| InChIKey | JVYQDXWZBLFPLB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |