C13H14O4 — CID 14713857
ethyl 4,6-dimethyl-1-oxo-3H-2-benzofuran-5-carboxylate (PubChem CID 14713857) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is ethyl 4,6-dimethyl-1-oxo-3H-2-benzofuran-5-carboxylate.
| Compound Name | ethyl 4,6-dimethyl-1-oxo-3H-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 14713857 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | ethyl 4,6-dimethyl-1-oxo-3H-2-benzofuran-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)cc2c(c1C)COC2=O |
| InChI | InChI=1S/C13H14O4/c1-4-16-13(15)11-7(2)5-9-10(8(11)3)6-17-12(9)14/h5H,4,6H2,1-3H3 |
| InChIKey | ANDTYPGORDYARJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |