C7H10BrN — CID 147152623
3-bromo-5-methyl-2-methylidene-3,4-dihydro-1H-pyridine (PubChem CID 147152623) has the molecular formula C7H10BrN and a molecular weight of 188.07 g/mol. Its IUPAC name is 3-bromo-5-methyl-2-methylidene-3,4-dihydro-1H-pyridine.
| Compound Name | 3-bromo-5-methyl-2-methylidene-3,4-dihydro-1H-pyridine |
|---|---|
| PubChem CID | 147152623 |
| Molecular Formula | C7H10BrN |
| Molecular Weight | 188.07 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | 3-bromo-5-methyl-2-methylidene-3,4-dihydro-1H-pyridine |
| SMILES | C=C1NC=C(C)CC1Br |
| InChI | InChI=1S/C7H10BrN/c1-5-3-7(8)6(2)9-4-5/h4,7,9H,2-3H2,1H3 |
| InChIKey | OGHXNYXJWPWIME-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.07 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|