C11H13N3 — CID 147261627
2-(4,5-dimethyl-1H-pyrazol-3-yl)-6-methylpyridine (PubChem CID 147261627) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 2-(4,5-dimethyl-1H-pyrazol-3-yl)-6-methylpyridine.
| Compound Name | 2-(4,5-dimethyl-1H-pyrazol-3-yl)-6-methylpyridine |
|---|---|
| PubChem CID | 147261627 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2-(4,5-dimethyl-1H-pyrazol-3-yl)-6-methylpyridine |
| SMILES | Cc1cccc(-c2n[nH]c(C)c2C)n1 |
| InChI | InChI=1S/C11H13N3/c1-7-5-4-6-10(12-7)11-8(2)9(3)13-14-11/h4-6H,1-3H3,(H,13,14) |
| InChIKey | CORCHYCBTGZEJQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |