C22H20N4 — CID 15427002
6,7-dimethyl-2,3-bis(6-methyl-2-pyridinyl)quinoxaline (PubChem CID 15427002) has the molecular formula C22H20N4 and a molecular weight of 340.43 g/mol. Its IUPAC name is 6,7-dimethyl-2,3-bis(6-methyl-2-pyridinyl)quinoxaline.
| Compound Name | 6,7-dimethyl-2,3-bis(6-methyl-2-pyridinyl)quinoxaline |
|---|---|
| PubChem CID | 15427002 |
| Molecular Formula | C22H20N4 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 6,7-dimethyl-2,3-bis(6-methyl-2-pyridinyl)quinoxaline |
| SMILES | Cc1cccc(-c2nc3cc(C)c(C)cc3nc2-c2cccc(C)n2)n1 |
| InChI | InChI=1S/C22H20N4/c1-13-11-19-20(12-14(13)2)26-22(18-10-6-8-16(4)24-18)21(25-19)17-9-5-7-15(3)23-17/h5-12H,1-4H3 |
| InChIKey | KOYJVRFETLSSMP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |