About [(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate
[(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 147279326) has the molecular formula C16H14F3NO5S
and a molecular weight of 389.35 g/mol. Its IUPAC name is [(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | [(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate |
| PubChem CID | 147279326 |
| Molecular Formula | C16H14F3NO5S |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | [(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C1C2C3C=C[C@@H](C3)C2C(O)N1OS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3NO5S/c17-16(18,19)10-3-5-11(6-4-10)26(23,24)25-20-14(21)12-8-1-2-9(7-8)13(12)15(20)22/h1-6,8-9,12-14,21H,7H2/t8-,9?,12?,13?,14?/m0/s1 |
| InChIKey | CRZCWWYNLXEQRP-BNDYRUQMSA-N |
| XLogP | 1.92 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate?
The IUPAC name of [(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate (CID 147279326) is [(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for [(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate?
The canonical SMILES for [(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate is O=C1C2C3C=C[C@@H](C3)C2C(O)N1OS(=O)(=O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of [(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate?
The InChIKey is CRZCWWYNLXEQRP-BNDYRUQMSA-N. The full InChI is InChI=1S/C16H14F3NO5S/c17-16(18,19)10-3-5-11(6-4-10)26(23,24)25-20-14(21)12-8-1-2-9(7-8)13(12)15(20)22/h1-6,8-9,12-14,21H,7H2/t8-,9?,12?,13?,14?/m0/s1.
What are the key properties of [(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate?
[(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate has a molecular weight of 389.35 g/mol, XLogP of 1.92, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-3-hydroxy-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl] 4-(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 147279326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).