C15H26F3N3 — CID 147285372
(2S,3Z)-5-methyl-3-N-[(1S)-1-[methyl-[(Z)-1,1,1-trifluoropent-2-en-2-yl]amino]ethyl]hexa-3,5-diene-2,3-diamine (PubChem CID 147285372) has the molecular formula C15H26F3N3 and a molecular weight of 305.39 g/mol. Its IUPAC name is (2S,3Z)-5-methyl-3-N-[(1S)-1-[methyl-[(Z)-1,1,1-trifluoropent-2-en-2-yl]amino]ethyl]hexa-3,5-diene-2,3-diamine.
| Compound Name | (2S,3Z)-5-methyl-3-N-[(1S)-1-[methyl-[(Z)-1,1,1-trifluoropent-2-en-2-yl]amino]ethyl]hexa-3,5-diene-2,3-diamine |
|---|---|
| PubChem CID | 147285372 |
| Molecular Formula | C15H26F3N3 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (2S,3Z)-5-methyl-3-N-[(1S)-1-[methyl-[(Z)-1,1,1-trifluoropent-2-en-2-yl]amino]ethyl]hexa-3,5-diene-2,3-diamine |
| SMILES | C=C(C)/C=C(\N[C@H](C)N(C)/C(=C\CC)C(F)(F)F)[C@H](C)N |
| InChI | InChI=1S/C15H26F3N3/c1-7-8-14(15(16,17)18)21(6)12(5)20-13(11(4)19)9-10(2)3/h8-9,11-12,20H,2,7,19H2,1,3-6H3/b13-9-,14-8-/t11-,12-/m0/s1 |
| InChIKey | CTDAPDGIMQNRRH-GADZREAQSA-N |
| XLogP | 3.52 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|