C25H29ClN4O7 — CID 147299118
(2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-2-[2-(piperidine-2-carbonylamino)ethoxy]acetic acid (PubChem CID 147299118) has the molecular formula C25H29ClN4O7 and a molecular weight of 532.98 g/mol. Its IUPAC name is (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-2-[2-(piperidine-2-carbonylamino)ethoxy]acetic acid.
| Compound Name | (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-2-[2-(piperidine-2-carbonylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 147299118 |
| Molecular Formula | C25H29ClN4O7 |
| Molecular Weight | 532.98 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | (2S)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-2-[2-(piperidine-2-carbonylamino)ethoxy]acetic acid |
| SMILES | O=C(NCc1cccc(O)c1)c1ccc(C(=O)N[C@@H](OCCNC(=O)C2CCCCN2)C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C25H29ClN4O7/c26-19-13-16(21(32)29-14-15-4-3-5-17(31)12-15)7-8-18(19)22(33)30-24(25(35)36)37-11-10-28-23(34)20-6-1-2-9-27-20/h3-5,7-8,12-13,20,24,27,31H,1-2,6,9-11,14H2,(H,28,34)(H,29,32)(H,30,33)(H,35,36)/t20?,24-/m0/s1 |
| InChIKey | CVSBCPJDRRCMHE-JWIMYKKASA-N |
| XLogP | 1.39 |
| TPSA | 166.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.98 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|