C11H20IN3O — CID 147326356
[4-amino-5-[amino(methyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methyl hypoiodite (PubChem CID 147326356) has the molecular formula C11H20IN3O and a molecular weight of 337.21 g/mol. Its IUPAC name is [4-amino-5-[amino(methyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methyl hypoiodite.
| Compound Name | [4-amino-5-[amino(methyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methyl hypoiodite |
|---|---|
| PubChem CID | 147326356 |
| Molecular Formula | C11H20IN3O |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | [4-amino-5-[amino(methyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methyl hypoiodite |
| SMILES | CN(N)C1=C(N)CCC2C(CC1)C2COI |
| InChI | InChI=1S/C11H20IN3O/c1-15(14)11-5-3-8-7(2-4-10(11)13)9(8)6-16-12/h7-9H,2-6,13-14H2,1H3 |
| InChIKey | DAULTVZQNYAUOA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|