C17H35N3O — CID 145240182
[(1R,4Z,8S,9R)-4-amino-5-[amino(2,2-dimethylpropyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methanol;ethane (PubChem CID 145240182) has the molecular formula C17H35N3O and a molecular weight of 297.49 g/mol. Its IUPAC name is [(1R,4Z,8S,9R)-4-amino-5-[amino(2,2-dimethylpropyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methanol;ethane.
| Compound Name | [(1R,4Z,8S,9R)-4-amino-5-[amino(2,2-dimethylpropyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methanol;ethane |
|---|---|
| PubChem CID | 145240182 |
| Molecular Formula | C17H35N3O |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.28 |
| IUPAC Name | [(1R,4Z,8S,9R)-4-amino-5-[amino(2,2-dimethylpropyl)amino]-9-bicyclo[6.1.0]non-4-enyl]methanol;ethane |
| SMILES | CC.CC(C)(C)CN(N)/C1=C(\N)CC[C@H]2[C@@H](CO)[C@H]2CC1 |
| InChI | InChI=1S/C15H29N3O.C2H6/c1-15(2,3)9-18(17)14-7-5-11-10(12(11)8-19)4-6-13(14)16;1-2/h10-12,19H,4-9,16-17H2,1-3H3;1-2H3/b14-13-;/t10-,11+,12-;/m1./s1 |
| InChIKey | IOAFXQXPEBUZLR-BNWATKGLSA-N |
| XLogP | 2.83 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|