C24H38BN3O7 — CID 147376085
tert-butyl N-[4-cyclopropyl-6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 147376085) has the molecular formula C24H38BN3O7 and a molecular weight of 491.39 g/mol. Its IUPAC name is tert-butyl N-[4-cyclopropyl-6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[4-cyclopropyl-6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 147376085 |
| Molecular Formula | C24H38BN3O7 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | tert-butyl N-[4-cyclopropyl-6-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | COc1nc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)nc(C2CC2)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H38BN3O7/c1-21(2,3)32-19(29)28(20(30)33-22(4,5)6)18-26-16(14-12-13-14)15(17(27-18)31-11)25-34-23(7,8)24(9,10)35-25/h14H,12-13H2,1-11H3 |
| InChIKey | DKASUQNQNRWLKQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 109.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|