C33H36Cl2F2N4O2 — CID 147378497
(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-N-[4-(dimethylcarbamoyl)phenyl]-5-(2,2-dimethylpropyl)-4-ethanimidoylpyrrolidine-2-carboxamide (PubChem CID 147378497) has the molecular formula C33H36Cl2F2N4O2 and a molecular weight of 629.58 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-N-[4-(dimethylcarbamoyl)phenyl]-5-(2,2-dimethylpropyl)-4-ethanimidoylpyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-N-[4-(dimethylcarbamoyl)phenyl]-5-(2,2-dimethylpropyl)-4-ethanimidoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 147378497 |
| Molecular Formula | C33H36Cl2F2N4O2 |
| Molecular Weight | 629.58 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-N-[4-(dimethylcarbamoyl)phenyl]-5-(2,2-dimethylpropyl)-4-ethanimidoylpyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\C)[C@]1(c2ccc(Cl)cc2F)[C@H](CC(C)(C)C)N[C@@H](C(=O)Nc2ccc(C(=O)N(C)C)cc2)[C@@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C33H36Cl2F2N4O2/c1-18(38)33(23-15-12-20(34)16-25(23)36)26(17-32(2,3)4)40-29(27(33)22-8-7-9-24(35)28(22)37)30(42)39-21-13-10-19(11-14-21)31(43)41(5)6/h7-16,26-27,29,38,40H,17H2,1-6H3,(H,39,42)/b38-18+/t26-,27-,29+,33-/m0/s1 |
| InChIKey | DKMKKUYXDGQYAP-NOIYYDMPSA-N |
| XLogP | 7.45 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.58 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|