C65H50F8N2O — CID 147385019
N-[4-[6-[4-(4-butan-2-ylphenoxy)-1,1,2,2,3,3,4,4-octafluorobutyl]-9-phenylcarbazol-3-yl]phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 147385019) has the molecular formula C65H50F8N2O and a molecular weight of 1027.11 g/mol. Its IUPAC name is N-[4-[6-[4-(4-butan-2-ylphenoxy)-1,1,2,2,3,3,4,4-octafluorobutyl]-9-phenylcarbazol-3-yl]phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | N-[4-[6-[4-(4-butan-2-ylphenoxy)-1,1,2,2,3,3,4,4-octafluorobutyl]-9-phenylcarbazol-3-yl]phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 147385019 |
| Molecular Formula | C65H50F8N2O |
| Molecular Weight | 1027.11 g/mol |
| Exact Mass | 1026.38 |
| IUPAC Name | N-[4-[6-[4-(4-butan-2-ylphenoxy)-1,1,2,2,3,3,4,4-octafluorobutyl]-9-phenylcarbazol-3-yl]phenyl]-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | CCC(C)c1ccc(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)c2ccc3c(c2)c2cc(-c4ccc(N(c5ccc(-c6ccccc6)cc5)c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc4)ccc2n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C65H50F8N2O/c1-5-41(2)42-24-33-52(34-25-42)76-65(72,73)64(70,71)63(68,69)62(66,67)47-27-37-60-56(39-47)55-38-46(26-36-59(55)75(60)48-16-10-7-11-17-48)45-22-30-50(31-23-45)74(49-28-20-44(21-29-49)43-14-8-6-9-15-43)51-32-35-54-53-18-12-13-19-57(53)61(3,4)58(54)40-51/h6-41H,5H2,1-4H3 |
| InChIKey | DLSNAIMEYJKXPE-UHFFFAOYSA-N |
| XLogP | 19.44 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.11 |
| LogP ≤ 5 | 19.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|