C9H16N2 — CID 147453175
5-cyclobutyl-2,3-dimethyl-1,5-dihydropyrazole (PubChem CID 147453175) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 5-cyclobutyl-2,3-dimethyl-1,5-dihydropyrazole.
| Compound Name | 5-cyclobutyl-2,3-dimethyl-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 147453175 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 5-cyclobutyl-2,3-dimethyl-1,5-dihydropyrazole |
| SMILES | CC1=CC(C2CCC2)NN1C |
| InChI | InChI=1S/C9H16N2/c1-7-6-9(10-11(7)2)8-4-3-5-8/h6,8-10H,3-5H2,1-2H3 |
| InChIKey | DYLPPPDHPXKGTM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |