C34H45F2N3O3 — CID 147492571
(2S)-2-[2-(2,2-difluorospiro[3.5]nonan-7-yl)-5-methylphenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 147492571) has the molecular formula C34H45F2N3O3 and a molecular weight of 581.75 g/mol. Its IUPAC name is (2S)-2-[2-(2,2-difluorospiro[3.5]nonan-7-yl)-5-methylphenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2S)-2-[2-(2,2-difluorospiro[3.5]nonan-7-yl)-5-methylphenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 147492571 |
| Molecular Formula | C34H45F2N3O3 |
| Molecular Weight | 581.75 g/mol |
| Exact Mass | 581.34 |
| IUPAC Name | (2S)-2-[2-(2,2-difluorospiro[3.5]nonan-7-yl)-5-methylphenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | Cc1ccc(C2CCC3(CC2)CC(F)(F)C3)c([C@@H](C(=O)O)N2CC[C@@H](OCCCCc3ccc4c(n3)NCCC4)C2)c1 |
| InChI | InChI=1S/C34H45F2N3O3/c1-23-7-10-28(24-11-14-33(15-12-24)21-34(35,36)22-33)29(19-23)30(32(40)41)39-17-13-27(20-39)42-18-3-2-6-26-9-8-25-5-4-16-37-31(25)38-26/h7-10,19,24,27,30H,2-6,11-18,20-22H2,1H3,(H,37,38)(H,40,41)/t27-,30+/m1/s1 |
| InChIKey | FFUZSGUGZLECDH-OFSOJUDTSA-N |
| XLogP | 7.06 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.75 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|