C26H15Cl3F4N2O6S — CID 147506160
3,5-dichloro-N-[4-[2-chloro-5-(trifluoromethyl)phenoxy]-2-fluorophenyl]-4-(2-methyl-4-nitrophenoxy)benzenesulfonamide (PubChem CID 147506160) has the molecular formula C26H15Cl3F4N2O6S and a molecular weight of 665.83 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-[2-chloro-5-(trifluoromethyl)phenoxy]-2-fluorophenyl]-4-(2-methyl-4-nitrophenoxy)benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-[4-[2-chloro-5-(trifluoromethyl)phenoxy]-2-fluorophenyl]-4-(2-methyl-4-nitrophenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 147506160 |
| Molecular Formula | C26H15Cl3F4N2O6S |
| Molecular Weight | 665.83 g/mol |
| Exact Mass | 663.97 |
| IUPAC Name | 3,5-dichloro-N-[4-[2-chloro-5-(trifluoromethyl)phenoxy]-2-fluorophenyl]-4-(2-methyl-4-nitrophenoxy)benzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1Oc1c(Cl)cc(S(=O)(=O)Nc2ccc(Oc3cc(C(F)(F)F)ccc3Cl)cc2F)cc1Cl |
| InChI | InChI=1S/C26H15Cl3F4N2O6S/c1-13-8-15(35(36)37)3-7-23(13)41-25-19(28)11-17(12-20(25)29)42(38,39)34-22-6-4-16(10-21(22)30)40-24-9-14(26(31,32)33)2-5-18(24)27/h2-12,34H,1H3 |
| InChIKey | FIJLBWAPKCUJBF-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.83 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|