C17H20N7O3+ — CID 147541937
[6-amino-5-(2-amino-1,3-benzoxazole-5-carboximidoyl)pyrimidin-4-yl]-(4-carboxybutyl)azanium (PubChem CID 147541937) has the molecular formula C17H20N7O3+ and a molecular weight of 370.39 g/mol. Its IUPAC name is [6-amino-5-(2-amino-1,3-benzoxazole-5-carboximidoyl)pyrimidin-4-yl]-(4-carboxybutyl)azanium.
| Compound Name | [6-amino-5-(2-amino-1,3-benzoxazole-5-carboximidoyl)pyrimidin-4-yl]-(4-carboxybutyl)azanium |
|---|---|
| PubChem CID | 147541937 |
| Molecular Formula | C17H20N7O3+ |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [6-amino-5-(2-amino-1,3-benzoxazole-5-carboximidoyl)pyrimidin-4-yl]-(4-carboxybutyl)azanium |
| SMILES | [H]/N=C(\c1ccc2oc(N)nc2c1)c1c(N)ncnc1[NH2+]CCCCC(=O)O |
| InChI | InChI=1S/C17H19N7O3/c18-14(9-4-5-11-10(7-9)24-17(20)27-11)13-15(19)22-8-23-16(13)21-6-2-1-3-12(25)26/h4-5,7-8,18H,1-3,6H2,(H2,20,24)(H,25,26)(H3,19,21,22,23)/p+1/b18-14+ |
| InChIKey | FPBYZCHQEJNASU-NBVRZTHBSA-O |
| XLogP | 0.65 |
| TPSA | 181.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|