C11H11N3O3 — CID 155758856
(Z)-2-amino-4-(2-amino-1,3-benzoxazol-5-yl)but-2-enoic acid (PubChem CID 155758856) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is (Z)-2-amino-4-(2-amino-1,3-benzoxazol-5-yl)but-2-enoic acid.
| Compound Name | (Z)-2-amino-4-(2-amino-1,3-benzoxazol-5-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 155758856 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (Z)-2-amino-4-(2-amino-1,3-benzoxazol-5-yl)but-2-enoic acid |
| SMILES | N/C(=C\Cc1ccc2oc(N)nc2c1)C(=O)O |
| InChI | InChI=1S/C11H11N3O3/c12-7(10(15)16)3-1-6-2-4-9-8(5-6)14-11(13)17-9/h2-5H,1,12H2,(H2,13,14)(H,15,16)/b7-3- |
| InChIKey | WUZLDYRYZJOQLE-CLTKARDFSA-N |
| XLogP | 0.88 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|