C44H80N2O6 — CID 147552886
1-O-[3,5-di(propan-2-yl)cyclohexyl] 1-O,7-O-bis[2,6-di(propan-2-yl)piperidin-4-yl] heptane-1,1,7-tricarboxylate (PubChem CID 147552886) has the molecular formula C44H80N2O6 and a molecular weight of 733.13 g/mol. Its IUPAC name is 1-O-[3,5-di(propan-2-yl)cyclohexyl] 1-O,7-O-bis[2,6-di(propan-2-yl)piperidin-4-yl] heptane-1,1,7-tricarboxylate.
| Compound Name | 1-O-[3,5-di(propan-2-yl)cyclohexyl] 1-O,7-O-bis[2,6-di(propan-2-yl)piperidin-4-yl] heptane-1,1,7-tricarboxylate |
|---|---|
| PubChem CID | 147552886 |
| Molecular Formula | C44H80N2O6 |
| Molecular Weight | 733.13 g/mol |
| Exact Mass | 732.60 |
| IUPAC Name | 1-O-[3,5-di(propan-2-yl)cyclohexyl] 1-O,7-O-bis[2,6-di(propan-2-yl)piperidin-4-yl] heptane-1,1,7-tricarboxylate |
| SMILES | CC(C)C1CC(OC(=O)C(CCCCCCC(=O)OC2CC(C(C)C)NC(C(C)C)C2)C(=O)OC2CC(C(C)C)NC(C(C)C)C2)CC(C(C)C)C1 |
| InChI | InChI=1S/C44H80N2O6/c1-26(2)32-19-33(27(3)4)21-34(20-32)51-43(48)37(44(49)52-36-24-40(30(9)10)46-41(25-36)31(11)12)17-15-13-14-16-18-42(47)50-35-22-38(28(5)6)45-39(23-35)29(7)8/h26-41,45-46H,13-25H2,1-12H3 |
| InChIKey | FRCRNZHWZJKEKQ-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.13 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|