C41H74N2O6 — CID 158684661
1-O-(3,3-dimethyl-5-propan-2-ylcyclohexyl) 1-O,7-O-bis(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) heptane-1,1,7-tricarboxylate (PubChem CID 158684661) has the molecular formula C41H74N2O6 and a molecular weight of 691.05 g/mol. Its IUPAC name is 1-O-(3,3-dimethyl-5-propan-2-ylcyclohexyl) 1-O,7-O-bis(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) heptane-1,1,7-tricarboxylate.
| Compound Name | 1-O-(3,3-dimethyl-5-propan-2-ylcyclohexyl) 1-O,7-O-bis(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) heptane-1,1,7-tricarboxylate |
|---|---|
| PubChem CID | 158684661 |
| Molecular Formula | C41H74N2O6 |
| Molecular Weight | 691.05 g/mol |
| Exact Mass | 690.55 |
| IUPAC Name | 1-O-(3,3-dimethyl-5-propan-2-ylcyclohexyl) 1-O,7-O-bis(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) heptane-1,1,7-tricarboxylate |
| SMILES | CC(C)C1CC(OC(=O)C(CCCCCCC(=O)OC2CC(C(C)C)NC(C)(C)C2)C(=O)OC2CC(C(C)C)NC(C)(C)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C41H74N2O6/c1-26(2)29-19-30(23-39(7,8)22-29)48-37(45)33(38(46)49-32-21-35(28(5)6)43-41(11,12)25-32)17-15-13-14-16-18-36(44)47-31-20-34(27(3)4)42-40(9,10)24-31/h26-35,42-43H,13-25H2,1-12H3 |
| InChIKey | IFORGVFCXNWWRE-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.05 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|