C11H12F3NO3S3 — CID 147553161
O-ethyl [3-(trifluoromethylsulfonylamino)phenyl]methylsulfanylmethanethioate (PubChem CID 147553161) has the molecular formula C11H12F3NO3S3 and a molecular weight of 359.42 g/mol. Its IUPAC name is O-ethyl [3-(trifluoromethylsulfonylamino)phenyl]methylsulfanylmethanethioate.
| Compound Name | O-ethyl [3-(trifluoromethylsulfonylamino)phenyl]methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 147553161 |
| Molecular Formula | C11H12F3NO3S3 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | O-ethyl [3-(trifluoromethylsulfonylamino)phenyl]methylsulfanylmethanethioate |
| SMILES | CCOC(=S)SCc1cccc(NS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3NO3S3/c1-2-18-10(19)20-7-8-4-3-5-9(6-8)15-21(16,17)11(12,13)14/h3-6,15H,2,7H2,1H3 |
| InChIKey | FREBZUVNRDOYFC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|